C12H24 — CID 57190910
2,5,8-trimethylnon-4-ene (PubChem CID 57190910) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is 2,5,8-trimethylnon-4-ene.
| Compound Name | 2,5,8-trimethylnon-4-ene |
|---|---|
| PubChem CID | 57190910 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | 2,5,8-trimethylnon-4-ene |
| SMILES | CC(=CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C12H24/c1-10(2)6-8-12(5)9-7-11(3)4/h8,10-11H,6-7,9H2,1-5H3 |
| InChIKey | SGDUNMBKIAEYII-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|