2-methyloct-2-enedioic acid

C9H14O4 — CID 57191247

IUPAC2-methyloct-2-enedioic acid
SMILESCC(=CCCCCC(=O)O)C(=O)O
InChIInChI=1S/C9H14O4/c1-7(9(12)13)5-3-2-4-6-8(10)11/h5H,2-4,6H2,1H3,(H,10,11)(H,12,13)
InChIKeyMDBTUOMOPSOAHA-UHFFFAOYSA-N
MW186.21 g/mol
LogP1.66
Rot. Bonds6

About 2-methyloct-2-enedioic acid

2-methyloct-2-enedioic acid (PubChem CID 57191247) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-methyloct-2-enedioic acid.

Molecular Properties

Compound Name2-methyloct-2-enedioic acid
PubChem CID57191247
Molecular FormulaC9H14O4
Molecular Weight186.21 g/mol
Exact Mass186.09
IUPAC Name2-methyloct-2-enedioic acid
SMILESCC(=CCCCCC(=O)O)C(=O)O
InChIInChI=1S/C9H14O4/c1-7(9(12)13)5-3-2-4-6-8(10)11/h5H,2-4,6H2,1H3,(H,10,11)(H,12,13)
InChIKeyMDBTUOMOPSOAHA-UHFFFAOYSA-N
XLogP1.66
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.21
LogP ≤ 51.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-methyloct-2-enedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyloct-2-enedioic acid?
The IUPAC name of 2-methyloct-2-enedioic acid (CID 57191247) is 2-methyloct-2-enedioic acid.
What is the SMILES notation for 2-methyloct-2-enedioic acid?
The canonical SMILES for 2-methyloct-2-enedioic acid is CC(=CCCCCC(=O)O)C(=O)O.
What is the InChIKey of 2-methyloct-2-enedioic acid?
The InChIKey is MDBTUOMOPSOAHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4/c1-7(9(12)13)5-3-2-4-6-8(10)11/h5H,2-4,6H2,1H3,(H,10,11)(H,12,13).
What are the key properties of 2-methyloct-2-enedioic acid?
2-methyloct-2-enedioic acid has a molecular weight of 186.21 g/mol, XLogP of 1.66, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloct-2-enedioic acid is sourced from PubChem (CID 57191247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).