C35H45N5O5 — CID 57191256
(2S)-2-amino-N-[(1R,2S)-1-[tert-butyl(cyclohexanecarbonyl)amino]-2-hydroxy-4-phenylbutyl]-N-(quinoline-2-carbonyl)butanediamide (PubChem CID 57191256) has the molecular formula C35H45N5O5 and a molecular weight of 615.78 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1R,2S)-1-[tert-butyl(cyclohexanecarbonyl)amino]-2-hydroxy-4-phenylbutyl]-N-(quinoline-2-carbonyl)butanediamide.
| Compound Name | (2S)-2-amino-N-[(1R,2S)-1-[tert-butyl(cyclohexanecarbonyl)amino]-2-hydroxy-4-phenylbutyl]-N-(quinoline-2-carbonyl)butanediamide |
|---|---|
| PubChem CID | 57191256 |
| Molecular Formula | C35H45N5O5 |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.34 |
| IUPAC Name | (2S)-2-amino-N-[(1R,2S)-1-[tert-butyl(cyclohexanecarbonyl)amino]-2-hydroxy-4-phenylbutyl]-N-(quinoline-2-carbonyl)butanediamide |
| SMILES | CC(C)(C)N(C(=O)C1CCCCC1)[C@@H]([C@@H](O)CCc1ccccc1)N(C(=O)c1ccc2ccccc2n1)C(=O)[C@@H](N)CC(N)=O |
| InChI | InChI=1S/C35H45N5O5/c1-35(2,3)40(32(43)25-15-8-5-9-16-25)31(29(41)21-18-23-12-6-4-7-13-23)39(33(44)26(36)22-30(37)42)34(45)28-20-19-24-14-10-11-17-27(24)38-28/h4,6-7,10-14,17,19-20,25-26,29,31,41H,5,8-9,15-16,18,21-22,36H2,1-3H3,(H2,37,42)/t26-,29-,31-/m0/s1 |
| InChIKey | ZVUCGFCQANPDFR-CRFLUJQRSA-N |
| XLogP | 3.93 |
| TPSA | 159.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|