C26H34N4O — CID 57191781
3-(6-amino-2-pyridinyl)-1-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]quinolin-2-one (PubChem CID 57191781) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 3-(6-amino-2-pyridinyl)-1-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]quinolin-2-one.
| Compound Name | 3-(6-amino-2-pyridinyl)-1-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]quinolin-2-one |
|---|---|
| PubChem CID | 57191781 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 3-(6-amino-2-pyridinyl)-1-[5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]pentyl]quinolin-2-one |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCCn1c(=O)c(-c2cccc(N)n2)cc2ccccc21 |
| InChI | InChI=1S/C26H34N4O/c1-19-10-8-11-20(2)29(19)16-6-3-7-17-30-24-14-5-4-12-21(24)18-22(26(30)31)23-13-9-15-25(27)28-23/h4-5,9,12-15,18-20H,3,6-8,10-11,16-17H2,1-2H3,(H2,27,28)/t19-,20+ |
| InChIKey | JFVMGNVAWSGFOC-BGYRXZFFSA-N |
| XLogP | 5.08 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|