C9H16O3 — CID 57191826
1-prop-2-enoxy-2-prop-2-enylpropane-1,3-diol (PubChem CID 57191826) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 1-prop-2-enoxy-2-prop-2-enylpropane-1,3-diol.
| Compound Name | 1-prop-2-enoxy-2-prop-2-enylpropane-1,3-diol |
|---|---|
| PubChem CID | 57191826 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 1-prop-2-enoxy-2-prop-2-enylpropane-1,3-diol |
| SMILES | C=CCOC(O)C(CO)CC=C |
| InChI | InChI=1S/C9H16O3/c1-3-5-8(7-10)9(11)12-6-4-2/h3-4,8-11H,1-2,5-7H2 |
| InChIKey | BHOLTKQQQSMCFG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|