About 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide
3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide (PubChem CID 57192023) has the molecular formula C9H8ClNO3S
and a molecular weight of 245.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide.
Analyze 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide?
The IUPAC name of 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide (CID 57192023) is 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide.
What is the SMILES notation for 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide?
The canonical SMILES for 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide is O=S1(=O)C=CONC1c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide?
The InChIKey is MFRONXASXXWRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO3S/c10-8-3-1-7(2-4-8)9-11-14-5-6-15(9,12)13/h1-6,9,11H.
What are the key properties of 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide?
3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide has a molecular weight of 245.69 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-2,3-dihydro-1,4,2-oxathiazine 4,4-dioxide is sourced from PubChem (CID 57192023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).