C8H9F5N4 — CID 57192105
[5-ethyl-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]hydrazine (PubChem CID 57192105) has the molecular formula C8H9F5N4 and a molecular weight of 256.18 g/mol. Its IUPAC name is [5-ethyl-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]hydrazine.
| Compound Name | [5-ethyl-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 57192105 |
| Molecular Formula | C8H9F5N4 |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | [5-ethyl-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-yl]hydrazine |
| SMILES | CCc1cnc(NN)nc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F5N4/c1-2-4-3-15-6(17-14)16-5(4)7(9,10)8(11,12)13/h3H,2,14H2,1H3,(H,15,16,17) |
| InChIKey | AMAUDXWHDYTTAD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|