About carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate
carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate (PubChem CID 57192267) has the molecular formula C6H7N3O5S2
and a molecular weight of 265.27 g/mol. Its IUPAC name is carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate.
Molecular Properties
| Compound Name | carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate |
| PubChem CID | 57192267 |
| Molecular Formula | C6H7N3O5S2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCS(=O)(=O)c1nnc(C(=O)OC(N)=O)s1 |
| InChI | InChI=1S/C6H7N3O5S2/c1-2-16(12,13)6-9-8-3(15-6)4(10)14-5(7)11/h2H2,1H3,(H2,7,11) |
| InChIKey | JWHPJBWSWBYRIW-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate?
The IUPAC name of carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate (CID 57192267) is carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate.
What is the SMILES notation for carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate?
The canonical SMILES for carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate is CCS(=O)(=O)c1nnc(C(=O)OC(N)=O)s1.
What is the InChIKey of carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate?
The InChIKey is JWHPJBWSWBYRIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O5S2/c1-2-16(12,13)6-9-8-3(15-6)4(10)14-5(7)11/h2H2,1H3,(H2,7,11).
What are the key properties of carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate?
carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate has a molecular weight of 265.27 g/mol, XLogP of -0.43, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for carbamoyl 5-ethylsulfonyl-1,3,4-thiadiazole-2-carboxylate is sourced from PubChem (CID 57192267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).