C17H31O5P — CID 57192304
1-[(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphanyl]propane-1,3-diol (PubChem CID 57192304) has the molecular formula C17H31O5P and a molecular weight of 346.40 g/mol. Its IUPAC name is 1-[(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphanyl]propane-1,3-diol.
| Compound Name | 1-[(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphanyl]propane-1,3-diol |
|---|---|
| PubChem CID | 57192304 |
| Molecular Formula | C17H31O5P |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphanyl]propane-1,3-diol |
| SMILES | CC(C)(C)c1ccc(P(O)(O)(O)C(O)CCO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H31O5P/c1-16(2,3)12-7-8-14(13(11-12)17(4,5)6)23(20,21,22)15(19)9-10-18/h7-8,11,15,18-22H,9-10H2,1-6H3 |
| InChIKey | RQKOZURUVXQALM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|