C22H28N2O5 — CID 57192957
[(2S,3S)-2-amino-3-hydroxy-3-methyl-4-phenylbutanoyl] (2S,3S)-2-amino-3-hydroxy-3-methyl-4-phenylbutanoate (PubChem CID 57192957) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is [(2S,3S)-2-amino-3-hydroxy-3-methyl-4-phenylbutanoyl] (2S,3S)-2-amino-3-hydroxy-3-methyl-4-phenylbutanoate.
| Compound Name | [(2S,3S)-2-amino-3-hydroxy-3-methyl-4-phenylbutanoyl] (2S,3S)-2-amino-3-hydroxy-3-methyl-4-phenylbutanoate |
|---|---|
| PubChem CID | 57192957 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [(2S,3S)-2-amino-3-hydroxy-3-methyl-4-phenylbutanoyl] (2S,3S)-2-amino-3-hydroxy-3-methyl-4-phenylbutanoate |
| SMILES | C[C@](O)(Cc1ccccc1)[C@H](N)C(=O)OC(=O)[C@@H](N)[C@@](C)(O)Cc1ccccc1 |
| InChI | InChI=1S/C22H28N2O5/c1-21(27,13-15-9-5-3-6-10-15)17(23)19(25)29-20(26)18(24)22(2,28)14-16-11-7-4-8-12-16/h3-12,17-18,27-28H,13-14,23-24H2,1-2H3/t17-,18-,21+,22+/m1/s1 |
| InChIKey | WVPBCERRNOMYOR-UBBRYJJRSA-N |
| XLogP | 0.70 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|