About 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate
2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate (PubChem CID 57192962) has the molecular formula C25H30N2O5
and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate.
Molecular Properties
| Compound Name | 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate |
| PubChem CID | 57192962 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate |
| SMILES | CCNC(=O)C(c1ccc(C(=O)OCCOC=O)cc1)c1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C25H30N2O5/c1-2-26-24(29)23(21-8-4-5-9-22(21)27-14-6-3-7-15-27)19-10-12-20(13-11-19)25(30)32-17-16-31-18-28/h4-5,8-13,18,23H,2-3,6-7,14-17H2,1H3,(H,26,29) |
| InChIKey | BHWGZWOHBOJMCH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate?
The IUPAC name of 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate (CID 57192962) is 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate.
What is the SMILES notation for 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate?
The canonical SMILES for 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate is CCNC(=O)C(c1ccc(C(=O)OCCOC=O)cc1)c1ccccc1N1CCCCC1.
What is the InChIKey of 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate?
The InChIKey is BHWGZWOHBOJMCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N2O5/c1-2-26-24(29)23(21-8-4-5-9-22(21)27-14-6-3-7-15-27)19-10-12-20(13-11-19)25(30)32-17-16-31-18-28/h4-5,8-13,18,23H,2-3,6-7,14-17H2,1H3,(H,26,29).
What are the key properties of 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate?
2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate has a molecular weight of 438.52 g/mol, XLogP of 3.27, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formyloxyethyl 4-[2-(ethylamino)-2-oxo-1-(2-piperidin-1-ylphenyl)ethyl]benzoate is sourced from PubChem (CID 57192962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).