About 6-hydroxydec-1-en-4-one
6-hydroxydec-1-en-4-one (PubChem CID 57193020) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 6-hydroxydec-1-en-4-one.
Molecular Properties
| Compound Name | 6-hydroxydec-1-en-4-one |
| PubChem CID | 57193020 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 6-hydroxydec-1-en-4-one |
| SMILES | C=CCC(=O)CC(O)CCCC |
| InChI | InChI=1S/C10H18O2/c1-3-5-7-10(12)8-9(11)6-4-2/h4,10,12H,2-3,5-8H2,1H3 |
| InChIKey | JCBNZLMVLSBLLF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxydec-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxydec-1-en-4-one?
The IUPAC name of 6-hydroxydec-1-en-4-one (CID 57193020) is 6-hydroxydec-1-en-4-one.
What is the SMILES notation for 6-hydroxydec-1-en-4-one?
The canonical SMILES for 6-hydroxydec-1-en-4-one is C=CCC(=O)CC(O)CCCC.
What is the InChIKey of 6-hydroxydec-1-en-4-one?
The InChIKey is JCBNZLMVLSBLLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-5-7-10(12)8-9(11)6-4-2/h4,10,12H,2-3,5-8H2,1H3.
What are the key properties of 6-hydroxydec-1-en-4-one?
6-hydroxydec-1-en-4-one has a molecular weight of 170.25 g/mol, XLogP of 2.07, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxydec-1-en-4-one is sourced from PubChem (CID 57193020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).