C16H21NO7 — CID 57193503
[(1R,2R,4S,6S,10S)-7-methoxycarbonyl-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] morpholine-4-carboxylate (PubChem CID 57193503) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is [(1R,2R,4S,6S,10S)-7-methoxycarbonyl-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] morpholine-4-carboxylate.
| Compound Name | [(1R,2R,4S,6S,10S)-7-methoxycarbonyl-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 57193503 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | [(1R,2R,4S,6S,10S)-7-methoxycarbonyl-2-methyl-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-10-yl] morpholine-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](OC(=O)N2CCOCC2)[C@@H]2[C@@H]1C[C@@H]1O[C@]21C |
| InChI | InChI=1S/C16H21NO7/c1-16-11(24-16)7-9-10(13(18)20-2)8-22-14(12(9)16)23-15(19)17-3-5-21-6-4-17/h8-9,11-12,14H,3-7H2,1-2H3/t9-,11+,12+,14+,16+/m1/s1 |
| InChIKey | SCVDEXPDZJMOLD-SYDMCVFHSA-N |
| XLogP | 0.66 |
| TPSA | 86.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|