C23H24N4O — CID 571937
2-amino-4-(4-butoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 571937) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-amino-4-(4-butoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | 2-amino-4-(4-butoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 571937 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 2-amino-4-(4-butoxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | CCCCOc1ccc(C2C3CCCC=C3C(C#N)=C(N)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C23H24N4O/c1-2-3-12-28-17-10-8-16(9-11-17)21-19-7-5-4-6-18(19)20(13-24)22(27)23(21,14-25)15-26/h6,8-11,19,21H,2-5,7,12,27H2,1H3 |
| InChIKey | HWWSFTYASYRFOB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|