C14H22N6O — CID 57194065
1-cyano-2-methyl-3-[3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-ylmethoxy)propyl]guanidine (PubChem CID 57194065) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-ylmethoxy)propyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 57194065 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-cyano-2-methyl-3-[3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-ylmethoxy)propyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCCOCc1ncc2n1CCCC2 |
| InChI | InChI=1S/C14H22N6O/c1-16-14(19-11-15)17-6-4-8-21-10-13-18-9-12-5-2-3-7-20(12)13/h9H,2-8,10H2,1H3,(H2,16,17,19) |
| InChIKey | SORPRQMQYRKZNQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|