C18H11F6N3O3 — CID 57194132
3-[4-carbamoyl-2-(trifluoromethyl)phenyl]-5-(trifluoromethoxy)indole-1-carboxamide (PubChem CID 57194132) has the molecular formula C18H11F6N3O3 and a molecular weight of 431.29 g/mol. Its IUPAC name is 3-[4-carbamoyl-2-(trifluoromethyl)phenyl]-5-(trifluoromethoxy)indole-1-carboxamide.
| Compound Name | 3-[4-carbamoyl-2-(trifluoromethyl)phenyl]-5-(trifluoromethoxy)indole-1-carboxamide |
|---|---|
| PubChem CID | 57194132 |
| Molecular Formula | C18H11F6N3O3 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 3-[4-carbamoyl-2-(trifluoromethyl)phenyl]-5-(trifluoromethoxy)indole-1-carboxamide |
| SMILES | NC(=O)c1ccc(-c2cn(C(N)=O)c3ccc(OC(F)(F)F)cc23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H11F6N3O3/c19-17(20,21)13-5-8(15(25)28)1-3-10(13)12-7-27(16(26)29)14-4-2-9(6-11(12)14)30-18(22,23)24/h1-7H,(H2,25,28)(H2,26,29) |
| InChIKey | MYUYFNKKLJCMRH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |