C38H43NO6 — CID 57194165
N-[1-[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1-(2,6-dimethoxyphenoxy)butyl]acetamide (PubChem CID 57194165) has the molecular formula C38H43NO6 and a molecular weight of 609.76 g/mol. Its IUPAC name is N-[1-[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1-(2,6-dimethoxyphenoxy)butyl]acetamide.
| Compound Name | N-[1-[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1-(2,6-dimethoxyphenoxy)butyl]acetamide |
|---|---|
| PubChem CID | 57194165 |
| Molecular Formula | C38H43NO6 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.31 |
| IUPAC Name | N-[1-[5,6-bis(phenylmethoxy)-1,2,3,4-tetrahydronaphthalen-1-yl]-1-(2,6-dimethoxyphenoxy)butyl]acetamide |
| SMILES | CCCC(NC(C)=O)(Oc1c(OC)cccc1OC)C1CCCc2c1ccc(OCc1ccccc1)c2OCc1ccccc1 |
| InChI | InChI=1S/C38H43NO6/c1-5-24-38(39-27(2)40,45-37-33(41-3)20-13-21-34(37)42-4)32-19-12-18-31-30(32)22-23-35(43-25-28-14-8-6-9-15-28)36(31)44-26-29-16-10-7-11-17-29/h6-11,13-17,20-23,32H,5,12,18-19,24-26H2,1-4H3,(H,39,40) |
| InChIKey | JFXOVASIOQHCQR-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|