C6H8F3N3O2S2 — CID 57194243
1,1,1-trifluoro-N-[2-(1H-imidazol-2-yl)-2-sulfanylethyl]methanesulfonamide (PubChem CID 57194243) has the molecular formula C6H8F3N3O2S2 and a molecular weight of 275.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-(1H-imidazol-2-yl)-2-sulfanylethyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[2-(1H-imidazol-2-yl)-2-sulfanylethyl]methanesulfonamide |
|---|---|
| PubChem CID | 57194243 |
| Molecular Formula | C6H8F3N3O2S2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-(1H-imidazol-2-yl)-2-sulfanylethyl]methanesulfonamide |
| SMILES | O=S(=O)(NCC(S)c1ncc[nH]1)C(F)(F)F |
| InChI | InChI=1S/C6H8F3N3O2S2/c7-6(8,9)16(13,14)12-3-4(15)5-10-1-2-11-5/h1-2,4,12,15H,3H2,(H,10,11) |
| InChIKey | ZILDKHGUPBGEBO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|