About 2-azabicyclo[2.2.2]octa-1,4(8),5-triene
2-azabicyclo[2.2.2]octa-1,4(8),5-triene (PubChem CID 57194488) has the molecular formula C7H7N
and a molecular weight of 105.14 g/mol. Its IUPAC name is 2-azabicyclo[2.2.2]octa-1,4(8),5-triene.
Molecular Properties
| Compound Name | 2-azabicyclo[2.2.2]octa-1,4(8),5-triene |
| PubChem CID | 57194488 |
| Molecular Formula | C7H7N |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 2-azabicyclo[2.2.2]octa-1,4(8),5-triene |
| SMILES | C1=CC2=NCC1=CC2 |
| InChI | InChI=1S/C7H7N/c1-3-7-4-2-6(1)5-8-7/h1-3H,4-5H2 |
| InChIKey | IFTMFJBZPNNXNN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-azabicyclo[2.2.2]octa-1,4(8),5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[2.2.2]octa-1,4(8),5-triene?
The IUPAC name of 2-azabicyclo[2.2.2]octa-1,4(8),5-triene (CID 57194488) is 2-azabicyclo[2.2.2]octa-1,4(8),5-triene.
What is the SMILES notation for 2-azabicyclo[2.2.2]octa-1,4(8),5-triene?
The canonical SMILES for 2-azabicyclo[2.2.2]octa-1,4(8),5-triene is C1=CC2=NCC1=CC2.
What is the InChIKey of 2-azabicyclo[2.2.2]octa-1,4(8),5-triene?
The InChIKey is IFTMFJBZPNNXNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N/c1-3-7-4-2-6(1)5-8-7/h1-3H,4-5H2.
What are the key properties of 2-azabicyclo[2.2.2]octa-1,4(8),5-triene?
2-azabicyclo[2.2.2]octa-1,4(8),5-triene has a molecular weight of 105.14 g/mol, XLogP of 1.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[2.2.2]octa-1,4(8),5-triene is sourced from PubChem (CID 57194488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).