About 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal
7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal (PubChem CID 57194511) has the molecular formula C13H24O2Si
and a molecular weight of 240.42 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal.
Molecular Properties
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal |
| PubChem CID | 57194511 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal |
| SMILES | CC(C)(C)[Si](C)(C)OCC=C=CCCC=O |
| InChI | InChI=1S/C13H24O2Si/c1-13(2,3)16(4,5)15-12-10-8-6-7-9-11-14/h6,10-11H,7,9,12H2,1-5H3 |
| InChIKey | HDWDDQXNFJXQEW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal?
The IUPAC name of 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal (CID 57194511) is 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal.
What is the SMILES notation for 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal?
The canonical SMILES for 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal is CC(C)(C)[Si](C)(C)OCC=C=CCCC=O.
What is the InChIKey of 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal?
The InChIKey is HDWDDQXNFJXQEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2Si/c1-13(2,3)16(4,5)15-12-10-8-6-7-9-11-14/h6,10-11H,7,9,12H2,1-5H3.
What are the key properties of 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal?
7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal has a molecular weight of 240.42 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[tert-butyl(dimethyl)silyl]oxyhepta-4,5-dienal is sourced from PubChem (CID 57194511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).