C36H48N2O6 — CID 57194589
3-[2-[[1-(3-phenylprop-2-enyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid (PubChem CID 57194589) has the molecular formula C36H48N2O6 and a molecular weight of 604.79 g/mol. Its IUPAC name is 3-[2-[[1-(3-phenylprop-2-enyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[2-[[1-(3-phenylprop-2-enyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57194589 |
| Molecular Formula | C36H48N2O6 |
| Molecular Weight | 604.79 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | 3-[2-[[1-(3-phenylprop-2-enyl)cyclobutanecarbonyl]amino]cyclohexyl]-3-[3-(2,2,5,5-tetramethyl-1,3-dioxane-4-carbonyl)-1H-pyrrol-2-yl]propanoic acid |
| SMILES | CC1(C)OCC(C)(C)C(C(=O)c2cc[nH]c2C(CC(=O)O)C2CCCCC2NC(=O)C2(CC=Cc3ccccc3)CCC2)O1 |
| InChI | InChI=1S/C36H48N2O6/c1-34(2)23-43-35(3,4)44-32(34)31(41)26-17-21-37-30(26)27(22-29(39)40)25-15-8-9-16-28(25)38-33(42)36(19-11-20-36)18-10-14-24-12-6-5-7-13-24/h5-7,10,12-14,17,21,25,27-28,32,37H,8-9,11,15-16,18-20,22-23H2,1-4H3,(H,38,42)(H,39,40) |
| InChIKey | NCZCVOBJUMDXHV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.79 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |