C18H25FN2O5 — CID 57194661
prop-2-enyl (2S)-4-fluoro-2-[4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 57194661) has the molecular formula C18H25FN2O5 and a molecular weight of 368.41 g/mol. Its IUPAC name is prop-2-enyl (2S)-4-fluoro-2-[4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S)-4-fluoro-2-[4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57194661 |
| Molecular Formula | C18H25FN2O5 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | prop-2-enyl (2S)-4-fluoro-2-[4-[(2R,3S)-3-[(1R)-1-hydroxyethyl]-4-oxoazetidin-2-yl]-2-methyl-3-oxobut-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1CC(F)C[C@H]1C=C(C)C(=O)C[C@H]1NC(=O)[C@@H]1[C@@H](C)O |
| InChI | InChI=1S/C18H25FN2O5/c1-4-5-26-18(25)21-9-12(19)7-13(21)6-10(2)15(23)8-14-16(11(3)22)17(24)20-14/h4,6,11-14,16,22H,1,5,7-9H2,2-3H3,(H,20,24)/t11-,12?,13-,14-,16-/m1/s1 |
| InChIKey | LUTXJUACTVOPOD-YMIMNMGWSA-N |
| XLogP | 1.12 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|