C30H32ClN8OS+ — CID 57194685
(3S)-1,1-bis[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)propyl]-3-methylpiperazin-1-ium-2-one (PubChem CID 57194685) has the molecular formula C30H32ClN8OS+ and a molecular weight of 588.16 g/mol. Its IUPAC name is (3S)-1,1-bis[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)propyl]-3-methylpiperazin-1-ium-2-one.
| Compound Name | (3S)-1,1-bis[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)propyl]-3-methylpiperazin-1-ium-2-one |
|---|---|
| PubChem CID | 57194685 |
| Molecular Formula | C30H32ClN8OS+ |
| Molecular Weight | 588.16 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | (3S)-1,1-bis[(4-aminoquinazolin-7-yl)methyl]-4-[3-(5-chlorothiophen-2-yl)propyl]-3-methylpiperazin-1-ium-2-one |
| SMILES | C[C@H]1C(=O)[N+](Cc2ccc3c(N)ncnc3c2)(Cc2ccc3c(N)ncnc3c2)CCN1CCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C30H32ClN8OS/c1-19-30(40)39(12-11-38(19)10-2-3-22-6-9-27(31)41-22,15-20-4-7-23-25(13-20)34-17-36-28(23)32)16-21-5-8-24-26(14-21)35-18-37-29(24)33/h4-9,13-14,17-19H,2-3,10-12,15-16H2,1H3,(H2,32,34,36)(H2,33,35,37)/q+1/t19-/m0/s1 |
| InChIKey | IWGUGBJEXQXNCE-IBGZPJMESA-N |
| XLogP | 4.83 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.16 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|