C14H22O6 — CID 57194714
5-acetyloxy-2-methylidene-4-(2,4,5-trimethyl-1,3-dioxolan-2-yl)pentanoic acid (PubChem CID 57194714) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 5-acetyloxy-2-methylidene-4-(2,4,5-trimethyl-1,3-dioxolan-2-yl)pentanoic acid.
| Compound Name | 5-acetyloxy-2-methylidene-4-(2,4,5-trimethyl-1,3-dioxolan-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 57194714 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 5-acetyloxy-2-methylidene-4-(2,4,5-trimethyl-1,3-dioxolan-2-yl)pentanoic acid |
| SMILES | C=C(CC(COC(C)=O)C1(C)OC(C)C(C)O1)C(=O)O |
| InChI | InChI=1S/C14H22O6/c1-8(13(16)17)6-12(7-18-11(4)15)14(5)19-9(2)10(3)20-14/h9-10,12H,1,6-7H2,2-5H3,(H,16,17) |
| InChIKey | CGJOKVTWOQKHSB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|