About isoquinolin-6-yl hydrogen carbonate
isoquinolin-6-yl hydrogen carbonate (PubChem CID 57194727) has the molecular formula C10H7NO3
and a molecular weight of 189.17 g/mol. Its IUPAC name is isoquinolin-6-yl hydrogen carbonate.
Molecular Properties
| Compound Name | isoquinolin-6-yl hydrogen carbonate |
| PubChem CID | 57194727 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | isoquinolin-6-yl hydrogen carbonate |
| SMILES | O=C(O)Oc1ccc2cnccc2c1 |
| InChI | InChI=1S/C10H7NO3/c12-10(13)14-9-2-1-8-6-11-4-3-7(8)5-9/h1-6H,(H,12,13) |
| InChIKey | ZYIWKPHUXVWBJD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze isoquinolin-6-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinolin-6-yl hydrogen carbonate?
The IUPAC name of isoquinolin-6-yl hydrogen carbonate (CID 57194727) is isoquinolin-6-yl hydrogen carbonate.
What is the SMILES notation for isoquinolin-6-yl hydrogen carbonate?
The canonical SMILES for isoquinolin-6-yl hydrogen carbonate is O=C(O)Oc1ccc2cnccc2c1.
What is the InChIKey of isoquinolin-6-yl hydrogen carbonate?
The InChIKey is ZYIWKPHUXVWBJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3/c12-10(13)14-9-2-1-8-6-11-4-3-7(8)5-9/h1-6H,(H,12,13).
What are the key properties of isoquinolin-6-yl hydrogen carbonate?
isoquinolin-6-yl hydrogen carbonate has a molecular weight of 189.17 g/mol, XLogP of 2.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinolin-6-yl hydrogen carbonate is sourced from PubChem (CID 57194727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).