C14H24O3 — CID 57194905
(1S,3aS,5R,7aR)-3a-hydroxy-5-(3-hydroxypropyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde (PubChem CID 57194905) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (1S,3aS,5R,7aR)-3a-hydroxy-5-(3-hydroxypropyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde.
| Compound Name | (1S,3aS,5R,7aR)-3a-hydroxy-5-(3-hydroxypropyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde |
|---|---|
| PubChem CID | 57194905 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (1S,3aS,5R,7aR)-3a-hydroxy-5-(3-hydroxypropyl)-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde |
| SMILES | C[C@]12CC[C@H](CCCO)C[C@@]1(O)CC[C@@H]2C=O |
| InChI | InChI=1S/C14H24O3/c1-13-6-4-11(3-2-8-15)9-14(13,17)7-5-12(13)10-16/h10-12,15,17H,2-9H2,1H3/t11-,12+,13+,14-/m0/s1 |
| InChIKey | PMRQLZUFEKDUQH-DGAVXFQQSA-N |
| XLogP | 1.91 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|