About 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol
1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol (PubChem CID 57194947) has the molecular formula C24H22N2O5
and a molecular weight of 418.45 g/mol. Its IUPAC name is 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol |
| PubChem CID | 57194947 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol |
| SMILES | C=CCOC(c1ccc(-n2c(O)ccc2O)cc1)c1ccc(-n2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C24H22N2O5/c1-2-15-31-24(16-3-7-18(8-4-16)25-20(27)11-12-21(25)28)17-5-9-19(10-6-17)26-22(29)13-14-23(26)30/h2-14,24,27-30H,1,15H2 |
| InChIKey | BODLAWKWYITJMY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol?
The IUPAC name of 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol (CID 57194947) is 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol.
What is the SMILES notation for 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol?
The canonical SMILES for 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol is C=CCOC(c1ccc(-n2c(O)ccc2O)cc1)c1ccc(-n2c(O)ccc2O)cc1.
What is the InChIKey of 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol?
The InChIKey is BODLAWKWYITJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O5/c1-2-15-31-24(16-3-7-18(8-4-16)25-20(27)11-12-21(25)28)17-5-9-19(10-6-17)26-22(29)13-14-23(26)30/h2-14,24,27-30H,1,15H2.
What are the key properties of 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol?
1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol has a molecular weight of 418.45 g/mol, XLogP of 4.38, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[4-(2,5-dihydroxypyrrol-1-yl)phenyl]-prop-2-enoxymethyl]phenyl]pyrrole-2,5-diol is sourced from PubChem (CID 57194947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).