C17H29NO2 — CID 57195044
N-(1-hydroxyethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide (PubChem CID 57195044) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is N-(1-hydroxyethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide.
| Compound Name | N-(1-hydroxyethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 57195044 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | N-(1-hydroxyethyl)-3,7,11-trimethyldodeca-2,6,10-trienamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(=O)NC(C)O |
| InChI | InChI=1S/C17H29NO2/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-17(20)18-16(5)19/h8,10,12,16,19H,6-7,9,11H2,1-5H3,(H,18,20) |
| InChIKey | IXYDSMPFLJWJAM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|