C19H22N4O — CID 57195132
8-methyl-6-(phenylhydrazinylidene)-2,3,4,7,8,9-hexahydro-1H-pyrido[2,1-b]quinazolin-11-one (PubChem CID 57195132) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 8-methyl-6-(phenylhydrazinylidene)-2,3,4,7,8,9-hexahydro-1H-pyrido[2,1-b]quinazolin-11-one.
| Compound Name | 8-methyl-6-(phenylhydrazinylidene)-2,3,4,7,8,9-hexahydro-1H-pyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 57195132 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 8-methyl-6-(phenylhydrazinylidene)-2,3,4,7,8,9-hexahydro-1H-pyrido[2,1-b]quinazolin-11-one |
| SMILES | CC1CC(=NNc2ccccc2)c2nc3c(c(=O)n2C1)CCCC3 |
| InChI | InChI=1S/C19H22N4O/c1-13-11-17(22-21-14-7-3-2-4-8-14)18-20-16-10-6-5-9-15(16)19(24)23(18)12-13/h2-4,7-8,13,21H,5-6,9-12H2,1H3 |
| InChIKey | BKTLEEJXLVYLPX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|