About 2,2-dibenzyl-1,4-dioxane
2,2-dibenzyl-1,4-dioxane (PubChem CID 57195201) has the molecular formula C18H20O2
and a molecular weight of 268.36 g/mol. Its IUPAC name is 2,2-dibenzyl-1,4-dioxane.
Molecular Properties
| Compound Name | 2,2-dibenzyl-1,4-dioxane |
| PubChem CID | 57195201 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2,2-dibenzyl-1,4-dioxane |
| SMILES | c1ccc(CC2(Cc3ccccc3)COCCO2)cc1 |
| InChI | InChI=1S/C18H20O2/c1-3-7-16(8-4-1)13-18(15-19-11-12-20-18)14-17-9-5-2-6-10-17/h1-10H,11-15H2 |
| InChIKey | WMZZVVAFMFWFBA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dibenzyl-1,4-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibenzyl-1,4-dioxane?
The IUPAC name of 2,2-dibenzyl-1,4-dioxane (CID 57195201) is 2,2-dibenzyl-1,4-dioxane.
What is the SMILES notation for 2,2-dibenzyl-1,4-dioxane?
The canonical SMILES for 2,2-dibenzyl-1,4-dioxane is c1ccc(CC2(Cc3ccccc3)COCCO2)cc1.
What is the InChIKey of 2,2-dibenzyl-1,4-dioxane?
The InChIKey is WMZZVVAFMFWFBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O2/c1-3-7-16(8-4-1)13-18(15-19-11-12-20-18)14-17-9-5-2-6-10-17/h1-10H,11-15H2.
What are the key properties of 2,2-dibenzyl-1,4-dioxane?
2,2-dibenzyl-1,4-dioxane has a molecular weight of 268.36 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibenzyl-1,4-dioxane is sourced from PubChem (CID 57195201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).