About propylidenethiourea
propylidenethiourea (PubChem CID 57195256) has the molecular formula C4H8N2S
and a molecular weight of 116.19 g/mol. Its IUPAC name is propylidenethiourea.
Molecular Properties
| Compound Name | propylidenethiourea |
| PubChem CID | 57195256 |
| Molecular Formula | C4H8N2S |
| Molecular Weight | 116.19 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | propylidenethiourea |
| SMILES | CCC=NC(N)=S |
| InChI | InChI=1S/C4H8N2S/c1-2-3-6-4(5)7/h3H,2H2,1H3,(H2,5,7) |
| InChIKey | BYMKDLSXVPJFDC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze propylidenethiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylidenethiourea?
The IUPAC name of propylidenethiourea (CID 57195256) is propylidenethiourea.
What is the SMILES notation for propylidenethiourea?
The canonical SMILES for propylidenethiourea is CCC=NC(N)=S.
What is the InChIKey of propylidenethiourea?
The InChIKey is BYMKDLSXVPJFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2S/c1-2-3-6-4(5)7/h3H,2H2,1H3,(H2,5,7).
What are the key properties of propylidenethiourea?
propylidenethiourea has a molecular weight of 116.19 g/mol, XLogP of 0.71, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propylidenethiourea is sourced from PubChem (CID 57195256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).