About 8aH-thiochromene
8aH-thiochromene (PubChem CID 57195514) has the molecular formula C9H8S
and a molecular weight of 148.23 g/mol. Its IUPAC name is 8aH-thiochromene.
Molecular Properties
| Compound Name | 8aH-thiochromene |
| PubChem CID | 57195514 |
| Molecular Formula | C9H8S |
| Molecular Weight | 148.23 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | 8aH-thiochromene |
| SMILES | C1=CSC2C=CC=CC2=C1 |
| InChI | InChI=1S/C9H8S/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7,9H |
| InChIKey | JTEBTEDTBSNFLE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8aH-thiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8aH-thiochromene?
The IUPAC name of 8aH-thiochromene (CID 57195514) is 8aH-thiochromene.
What is the SMILES notation for 8aH-thiochromene?
The canonical SMILES for 8aH-thiochromene is C1=CSC2C=CC=CC2=C1.
What is the InChIKey of 8aH-thiochromene?
The InChIKey is JTEBTEDTBSNFLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8S/c1-2-6-9-8(4-1)5-3-7-10-9/h1-7,9H.
What are the key properties of 8aH-thiochromene?
8aH-thiochromene has a molecular weight of 148.23 g/mol, XLogP of 2.67, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8aH-thiochromene is sourced from PubChem (CID 57195514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).