C16H16O5 — CID 57196043
methyl (1Z)-6-oxo-8,10-dioxatricyclo[10.4.0.02,7]hexadeca-1,3,11,13-tetraene-9-carboxylate (PubChem CID 57196043) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl (1Z)-6-oxo-8,10-dioxatricyclo[10.4.0.02,7]hexadeca-1,3,11,13-tetraene-9-carboxylate.
| Compound Name | methyl (1Z)-6-oxo-8,10-dioxatricyclo[10.4.0.02,7]hexadeca-1,3,11,13-tetraene-9-carboxylate |
|---|---|
| PubChem CID | 57196043 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | methyl (1Z)-6-oxo-8,10-dioxatricyclo[10.4.0.02,7]hexadeca-1,3,11,13-tetraene-9-carboxylate |
| SMILES | COC(=O)C1OC=C2C=CCC/C2=C2\C=CCC(=O)C2O1 |
| InChI | InChI=1S/C16H16O5/c1-19-15(18)16-20-9-10-5-2-3-6-11(10)12-7-4-8-13(17)14(12)21-16/h2,4-5,7,9,14,16H,3,6,8H2,1H3/b10-9?,12-11- |
| InChIKey | VVEJUHCZXMARCS-BUAZCGNSSA-N |
| XLogP | 1.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |