C17H17F4N5O — CID 57196470
2-N-[1-(6,7-dimethyl-1-benzofuran-2-yl)ethyl]-6-(1,1,2,2-tetrafluoroethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 57196470) has the molecular formula C17H17F4N5O and a molecular weight of 383.35 g/mol. Its IUPAC name is 2-N-[1-(6,7-dimethyl-1-benzofuran-2-yl)ethyl]-6-(1,1,2,2-tetrafluoroethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[1-(6,7-dimethyl-1-benzofuran-2-yl)ethyl]-6-(1,1,2,2-tetrafluoroethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 57196470 |
| Molecular Formula | C17H17F4N5O |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-N-[1-(6,7-dimethyl-1-benzofuran-2-yl)ethyl]-6-(1,1,2,2-tetrafluoroethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc2cc(C(C)Nc3nc(N)nc(C(F)(F)C(F)F)n3)oc2c1C |
| InChI | InChI=1S/C17H17F4N5O/c1-7-4-5-10-6-11(27-12(10)8(7)2)9(3)23-16-25-14(24-15(22)26-16)17(20,21)13(18)19/h4-6,9,13H,1-3H3,(H3,22,23,24,25,26) |
| InChIKey | GAUVYUGVOITTFE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|