About 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole
2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole (PubChem CID 57196534) has the molecular formula C15H21ClN2
and a molecular weight of 264.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole |
| PubChem CID | 57196534 |
| Molecular Formula | C15H21ClN2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole |
| SMILES | CCCN1C=CN(CCC)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClN2/c1-3-9-17-11-12-18(10-4-2)15(17)13-5-7-14(16)8-6-13/h5-8,11-12,15H,3-4,9-10H2,1-2H3 |
| InChIKey | WUUVWNLZMCBBJM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole?
The IUPAC name of 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole (CID 57196534) is 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole.
What is the SMILES notation for 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole?
The canonical SMILES for 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole is CCCN1C=CN(CCC)C1c1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole?
The InChIKey is WUUVWNLZMCBBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClN2/c1-3-9-17-11-12-18(10-4-2)15(17)13-5-7-14(16)8-6-13/h5-8,11-12,15H,3-4,9-10H2,1-2H3.
What are the key properties of 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole?
2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole has a molecular weight of 264.80 g/mol, XLogP of 4.25, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1,3-dipropyl-2H-imidazole is sourced from PubChem (CID 57196534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).