About (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione
(5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione (PubChem CID 57197029) has the molecular formula C6H8O8
and a molecular weight of 208.12 g/mol. Its IUPAC name is (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione.
Molecular Properties
| Compound Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione |
| PubChem CID | 57197029 |
| Molecular Formula | C6H8O8 |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione |
| SMILES | O=C1O[C@](O)([C@@H](O)CO)C(OO)C1=O |
| InChI | InChI=1S/C6H8O8/c7-1-2(8)6(11)4(14-12)3(9)5(10)13-6/h2,4,7-8,11-12H,1H2/t2-,4?,6+/m0/s1 |
| InChIKey | WUCKXJAFKBHHPJ-WBHHNASESA-N |
| XLogP | -2.99 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione?
The IUPAC name of (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione (CID 57197029) is (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione.
What is the SMILES notation for (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione?
The canonical SMILES for (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione is O=C1O[C@](O)([C@@H](O)CO)C(OO)C1=O.
What is the InChIKey of (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione?
The InChIKey is WUCKXJAFKBHHPJ-WBHHNASESA-N. The full InChI is InChI=1S/C6H8O8/c7-1-2(8)6(11)4(14-12)3(9)5(10)13-6/h2,4,7-8,11-12H,1H2/t2-,4?,6+/m0/s1.
What are the key properties of (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione?
(5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione has a molecular weight of 208.12 g/mol, XLogP of -2.99, 3 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[(1S)-1,2-dihydroxyethyl]-4-hydroperoxy-5-hydroxyoxolane-2,3-dione is sourced from PubChem (CID 57197029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).