C26H44F2O6 — CID 57197550
methyl 7-[(1R,2R,3R,5S)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-5-hydroxy-3-[(2S)-oxan-2-yl]oxycyclopentyl]hept-5-enoate (PubChem CID 57197550) has the molecular formula C26H44F2O6 and a molecular weight of 490.63 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-5-hydroxy-3-[(2S)-oxan-2-yl]oxycyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-5-hydroxy-3-[(2S)-oxan-2-yl]oxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 57197550 |
| Molecular Formula | C26H44F2O6 |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-2-[(4R)-5,5-difluoro-4-hydroxyoctyl]-5-hydroxy-3-[(2S)-oxan-2-yl]oxycyclopentyl]hept-5-enoate |
| SMILES | CCCC(F)(F)[C@H](O)CCC[C@@H]1[C@@H](CC=CCCCC(=O)OC)[C@@H](O)C[C@H]1O[C@H]1CCCCO1 |
| InChI | InChI=1S/C26H44F2O6/c1-3-16-26(27,28)23(30)13-10-12-20-19(11-6-4-5-7-14-24(31)32-2)21(29)18-22(20)34-25-15-8-9-17-33-25/h4,6,19-23,25,29-30H,3,5,7-18H2,1-2H3/t19-,20-,21+,22-,23-,25+/m1/s1 |
| InChIKey | VPEVNGWSTUSVRZ-BEOWLDHZSA-N |
| XLogP | 5.15 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|