C8H10Cl4F4O — CID 57197800
1,2-dichloro-3-(3,4-dichloro-3,4-difluorobutan-2-yl)oxy-1,2-difluorobutane (PubChem CID 57197800) has the molecular formula C8H10Cl4F4O and a molecular weight of 339.97 g/mol. Its IUPAC name is 1,2-dichloro-3-(3,4-dichloro-3,4-difluorobutan-2-yl)oxy-1,2-difluorobutane.
| Compound Name | 1,2-dichloro-3-(3,4-dichloro-3,4-difluorobutan-2-yl)oxy-1,2-difluorobutane |
|---|---|
| PubChem CID | 57197800 |
| Molecular Formula | C8H10Cl4F4O |
| Molecular Weight | 339.97 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | 1,2-dichloro-3-(3,4-dichloro-3,4-difluorobutan-2-yl)oxy-1,2-difluorobutane |
| SMILES | CC(OC(C)C(F)(Cl)C(F)Cl)C(F)(Cl)C(F)Cl |
| InChI | InChI=1S/C8H10Cl4F4O/c1-3(7(11,15)5(9)13)17-4(2)8(12,16)6(10)14/h3-6H,1-2H3 |
| InChIKey | ZTVPVMPJWOCTAV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.97 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|