About 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane
2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane (PubChem CID 57197870) has the molecular formula C20H42O
and a molecular weight of 298.56 g/mol. Its IUPAC name is 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane.
Molecular Properties
| Compound Name | 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane |
| PubChem CID | 57197870 |
| Molecular Formula | C20H42O |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.32 |
| IUPAC Name | 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane |
| SMILES | CCC(C)(C)CCCC(C)OC(C)CCCC(C)(C)CC |
| InChI | InChI=1S/C20H42O/c1-9-19(5,6)15-11-13-17(3)21-18(4)14-12-16-20(7,8)10-2/h17-18H,9-16H2,1-8H3 |
| InChIKey | HTGDDEMKJCQVHO-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane?
The IUPAC name of 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane (CID 57197870) is 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane.
What is the SMILES notation for 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane?
The canonical SMILES for 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane is CCC(C)(C)CCCC(C)OC(C)CCCC(C)(C)CC.
What is the InChIKey of 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane?
The InChIKey is HTGDDEMKJCQVHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H42O/c1-9-19(5,6)15-11-13-17(3)21-18(4)14-12-16-20(7,8)10-2/h17-18H,9-16H2,1-8H3.
What are the key properties of 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane?
2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane has a molecular weight of 298.56 g/mol, XLogP of 6.99, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,6-dimethyloctan-2-yloxy)-6,6-dimethyloctane is sourced from PubChem (CID 57197870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).