C20H24O — CID 57198131
2,3,3,4,4-pentamethyl-2-phenylchromene (PubChem CID 57198131) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is 2,3,3,4,4-pentamethyl-2-phenylchromene.
| Compound Name | 2,3,3,4,4-pentamethyl-2-phenylchromene |
|---|---|
| PubChem CID | 57198131 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2,3,3,4,4-pentamethyl-2-phenylchromene |
| SMILES | CC1(C)c2ccccc2OC(C)(c2ccccc2)C1(C)C |
| InChI | InChI=1S/C20H24O/c1-18(2)16-13-9-10-14-17(16)21-20(5,19(18,3)4)15-11-7-6-8-12-15/h6-14H,1-5H3 |
| InChIKey | SKIXNJKUPDUBCP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |