About 4H-pyrimido[4,5-c]diazepine
4H-pyrimido[4,5-c]diazepine (PubChem CID 57198261) has the molecular formula C7H6N4
and a molecular weight of 146.15 g/mol. Its IUPAC name is 4H-pyrimido[4,5-c]diazepine.
Molecular Properties
| Compound Name | 4H-pyrimido[4,5-c]diazepine |
| PubChem CID | 57198261 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 4H-pyrimido[4,5-c]diazepine |
| SMILES | C1=NN=c2ncncc2=CC1 |
| InChI | InChI=1S/C7H6N4/c1-2-6-4-8-5-9-7(6)11-10-3-1/h2-5H,1H2 |
| InChIKey | IDOFIIIPFXBYSZ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-pyrimido[4,5-c]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrimido[4,5-c]diazepine?
The IUPAC name of 4H-pyrimido[4,5-c]diazepine (CID 57198261) is 4H-pyrimido[4,5-c]diazepine.
What is the SMILES notation for 4H-pyrimido[4,5-c]diazepine?
The canonical SMILES for 4H-pyrimido[4,5-c]diazepine is C1=NN=c2ncncc2=CC1.
What is the InChIKey of 4H-pyrimido[4,5-c]diazepine?
The InChIKey is IDOFIIIPFXBYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4/c1-2-6-4-8-5-9-7(6)11-10-3-1/h2-5H,1H2.
What are the key properties of 4H-pyrimido[4,5-c]diazepine?
4H-pyrimido[4,5-c]diazepine has a molecular weight of 146.15 g/mol, XLogP of -0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrimido[4,5-c]diazepine is sourced from PubChem (CID 57198261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).