About 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine
2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine (PubChem CID 57198539) has the molecular formula C7H12FN
and a molecular weight of 129.18 g/mol. Its IUPAC name is 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine.
Molecular Properties
| Compound Name | 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine |
| PubChem CID | 57198539 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine |
| SMILES | CC1CCCC=NC1F |
| InChI | InChI=1S/C7H12FN/c1-6-4-2-3-5-9-7(6)8/h5-7H,2-4H2,1H3 |
| InChIKey | MDAYIARKVZBKGH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine?
The IUPAC name of 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine (CID 57198539) is 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine.
What is the SMILES notation for 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine?
The canonical SMILES for 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine is CC1CCCC=NC1F.
What is the InChIKey of 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine?
The InChIKey is MDAYIARKVZBKGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FN/c1-6-4-2-3-5-9-7(6)8/h5-7H,2-4H2,1H3.
What are the key properties of 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine?
2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine has a molecular weight of 129.18 g/mol, XLogP of 2.17, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3-methyl-3,4,5,6-tetrahydro-2H-azepine is sourced from PubChem (CID 57198539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).