C16H20O4 — CID 57198645
methyl 4-[(1R,2R,3S,6R)-3-hydroxy-2-(1-hydroxycycloprop-2-yn-1-yl)-7-bicyclo[4.2.0]octanylidene]butanoate (PubChem CID 57198645) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is methyl 4-[(1R,2R,3S,6R)-3-hydroxy-2-(1-hydroxycycloprop-2-yn-1-yl)-7-bicyclo[4.2.0]octanylidene]butanoate.
| Compound Name | methyl 4-[(1R,2R,3S,6R)-3-hydroxy-2-(1-hydroxycycloprop-2-yn-1-yl)-7-bicyclo[4.2.0]octanylidene]butanoate |
|---|---|
| PubChem CID | 57198645 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl 4-[(1R,2R,3S,6R)-3-hydroxy-2-(1-hydroxycycloprop-2-yn-1-yl)-7-bicyclo[4.2.0]octanylidene]butanoate |
| SMILES | COC(=O)CCC=C1C[C@H]2[C@@H](C3(O)C#C3)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C16H20O4/c1-20-14(18)4-2-3-10-9-12-11(10)5-6-13(17)15(12)16(19)7-8-16/h3,11-13,15,17,19H,2,4-6,9H2,1H3/t11-,12+,13-,15+/m0/s1 |
| InChIKey | PEEGXIZXWRVOMC-SFDCQRBFSA-N |
| XLogP | 1.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|