C27H32ClN3O — CID 57199338
9-N-(2-chlorophenyl)-3-N,3-N,6-N,6-N-tetraethyl-9H-xanthene-3,6,9-triamine (PubChem CID 57199338) has the molecular formula C27H32ClN3O and a molecular weight of 450.03 g/mol. Its IUPAC name is 9-N-(2-chlorophenyl)-3-N,3-N,6-N,6-N-tetraethyl-9H-xanthene-3,6,9-triamine.
| Compound Name | 9-N-(2-chlorophenyl)-3-N,3-N,6-N,6-N-tetraethyl-9H-xanthene-3,6,9-triamine |
|---|---|
| PubChem CID | 57199338 |
| Molecular Formula | C27H32ClN3O |
| Molecular Weight | 450.03 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 9-N-(2-chlorophenyl)-3-N,3-N,6-N,6-N-tetraethyl-9H-xanthene-3,6,9-triamine |
| SMILES | CCN(CC)c1ccc2c(c1)Oc1cc(N(CC)CC)ccc1C2Nc1ccccc1Cl |
| InChI | InChI=1S/C27H32ClN3O/c1-5-30(6-2)19-13-15-21-25(17-19)32-26-18-20(31(7-3)8-4)14-16-22(26)27(21)29-24-12-10-9-11-23(24)28/h9-18,27,29H,5-8H2,1-4H3 |
| InChIKey | SYMKHGRGQFZPPX-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.03 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|