About 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one
4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one (PubChem CID 57199729) has the molecular formula C9H15N5O
and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one.
Molecular Properties
| Compound Name | 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one |
| PubChem CID | 57199729 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one |
| SMILES | CC1NCCC1Cn1cnc(N)nc1=O |
| InChI | InChI=1S/C9H15N5O/c1-6-7(2-3-11-6)4-14-5-12-8(10)13-9(14)15/h5-7,11H,2-4H2,1H3,(H2,10,13,15) |
| InChIKey | BYFZTGYCEMPJQX-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one?
The IUPAC name of 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one (CID 57199729) is 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one.
What is the SMILES notation for 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one?
The canonical SMILES for 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one is CC1NCCC1Cn1cnc(N)nc1=O.
What is the InChIKey of 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one?
The InChIKey is BYFZTGYCEMPJQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O/c1-6-7(2-3-11-6)4-14-5-12-8(10)13-9(14)15/h5-7,11H,2-4H2,1H3,(H2,10,13,15).
What are the key properties of 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one?
4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one has a molecular weight of 209.25 g/mol, XLogP of -0.78, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-[(2-methylpyrrolidin-3-yl)methyl]-1,3,5-triazin-2-one is sourced from PubChem (CID 57199729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).