C21H35FO4 — CID 57199731
3a-[(4R)-4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 57199731) has the molecular formula C21H35FO4 and a molecular weight of 370.51 g/mol. Its IUPAC name is 3a-[(4R)-4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | 3a-[(4R)-4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 57199731 |
| Molecular Formula | C21H35FO4 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 3a-[(4R)-4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CCCC[C@@H](F)CC=C(OC1CCCCO1)C12CCCC1(C)OC(O)C2 |
| InChI | InChI=1S/C21H35FO4/c1-3-4-8-16(22)10-11-17(25-19-9-5-6-14-24-19)21-13-7-12-20(21,2)26-18(23)15-21/h11,16,18-19,23H,3-10,12-15H2,1-2H3/t16-,18?,19?,20?,21?/m1/s1 |
| InChIKey | FYYHMUQMPUMARE-WXYKMOQMSA-N |
| XLogP | 5.00 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|