C22H34O2 — CID 57199889
(8S,9R,10S,13S,14S)-2-hydroxy-10,13-dimethyl-2-prop-1-enyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 57199889) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is (8S,9R,10S,13S,14S)-2-hydroxy-10,13-dimethyl-2-prop-1-enyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,13S,14S)-2-hydroxy-10,13-dimethyl-2-prop-1-enyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 57199889 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | (8S,9R,10S,13S,14S)-2-hydroxy-10,13-dimethyl-2-prop-1-enyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC=CC1(O)C[C@@]2(C)C(CC[C@@H]3[C@H]2CC[C@]2(C)CCC[C@@H]32)CC1=O |
| InChI | InChI=1S/C22H34O2/c1-4-10-22(24)14-21(3)15(13-19(22)23)7-8-16-17-6-5-11-20(17,2)12-9-18(16)21/h4,10,15-18,24H,5-9,11-14H2,1-3H3/t15?,16-,17-,18+,20-,21-,22?/m0/s1 |
| InChIKey | RAUZDUXVSNEYJZ-GXHSFIIWSA-N |
| XLogP | 4.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|