About methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate
methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate (PubChem CID 57200454) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate.
Molecular Properties
| Compound Name | methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate |
| PubChem CID | 57200454 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate |
| SMILES | COC(=O)C(C)=CC1COC(C)(C)O1 |
| InChI | InChI=1S/C10H16O4/c1-7(9(11)12-4)5-8-6-13-10(2,3)14-8/h5,8H,6H2,1-4H3 |
| InChIKey | REPBGWQGPXXIEJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate?
The IUPAC name of methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate (CID 57200454) is methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate.
What is the SMILES notation for methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate?
The canonical SMILES for methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate is COC(=O)C(C)=CC1COC(C)(C)O1.
What is the InChIKey of methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate?
The InChIKey is REPBGWQGPXXIEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-7(9(11)12-4)5-8-6-13-10(2,3)14-8/h5,8H,6H2,1-4H3.
What are the key properties of methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate?
methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate has a molecular weight of 200.23 g/mol, XLogP of 1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-methylprop-2-enoate is sourced from PubChem (CID 57200454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).