C30H42N2O4S — CID 57200738
8,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-azacyclohexadec-13-ene-2,6-dione (PubChem CID 57200738) has the molecular formula C30H42N2O4S and a molecular weight of 526.74 g/mol. Its IUPAC name is 8,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-azacyclohexadec-13-ene-2,6-dione.
| Compound Name | 8,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-azacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 57200738 |
| Molecular Formula | C30H42N2O4S |
| Molecular Weight | 526.74 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 8,8-dihydroxy-5,5,9,13-tetramethyl-16-(2-methyl-1,3-benzothiazol-5-yl)-7-prop-2-enyl-1-azacyclohexadec-13-ene-2,6-dione |
| SMILES | C=CCC1C(=O)C(C)(C)CCC(=O)NC(c2ccc3sc(C)nc3c2)CC=C(C)CCCC(C)C1(O)O |
| InChI | InChI=1S/C30H42N2O4S/c1-7-9-23-28(34)29(5,6)17-16-27(33)32-24(22-13-15-26-25(18-22)31-21(4)37-26)14-12-19(2)10-8-11-20(3)30(23,35)36/h7,12-13,15,18,20,23-24,35-36H,1,8-11,14,16-17H2,2-6H3,(H,32,33) |
| InChIKey | PRKMWHIPPPKKRH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.74 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|