About 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol
2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol (PubChem CID 57200883) has the molecular formula C6H12N4S
and a molecular weight of 172.26 g/mol. Its IUPAC name is 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol.
Molecular Properties
| Compound Name | 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol |
| PubChem CID | 57200883 |
| Molecular Formula | C6H12N4S |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol |
| SMILES | CC(NCCS)c1ncn[nH]1 |
| InChI | InChI=1S/C6H12N4S/c1-5(7-2-3-11)6-8-4-9-10-6/h4-5,7,11H,2-3H2,1H3,(H,8,9,10) |
| InChIKey | ZRFIYSNDXOQHDH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol?
The IUPAC name of 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol (CID 57200883) is 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol.
What is the SMILES notation for 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol?
The canonical SMILES for 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol is CC(NCCS)c1ncn[nH]1.
What is the InChIKey of 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol?
The InChIKey is ZRFIYSNDXOQHDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4S/c1-5(7-2-3-11)6-8-4-9-10-6/h4-5,7,11H,2-3H2,1H3,(H,8,9,10).
What are the key properties of 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol?
2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol has a molecular weight of 172.26 g/mol, XLogP of 0.39, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1H-1,2,4-triazol-5-yl)ethylamino]ethanethiol is sourced from PubChem (CID 57200883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).